5-IODO-1-METHYL-1H-PYRAZOLE
Catalog No: FT-0647071
CAS No: 34091-51-5
- Chemical Name: 5-IODO-1-METHYL-1H-PYRAZOLE
- Molecular Formula: C4H5IN2
- Molecular Weight: 208
- InChI Key: RJYWUQWCLZYCTI-UHFFFAOYSA-N
- InChI: InChI=1S/C4H5IN2/c1-7-4(5)2-3-6-7/h2-3H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 208.000 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 34091-51-5 |
| Bolling_Point: | 226.9±13.0 °C at 760 mmHg |
| Product_Name: | 5-Iodo-1-methyl-1H-pyrazole |
| Melting_Point: | N/A |
| Flash_Point: | 91.1±19.8 °C |
| MF: | C4H5IN2 |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 1.50 |
| Flash_Point: | 91.1±19.8 °C |
| Refractive_Index: | 1.681 |
| FW: | 208.000 |
| PSA: | 17.82000 |
| MF: | C4H5IN2 |
| Bolling_Point: | 226.9±13.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| Exact_Mass: | 207.949738 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H315-H318-H335 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)